Product Description of Pagoclone CAS#133737-32-3
Pagoclone is a selective GABA (gamma-aminobutyric acid) receptor modulator that has been investigated for its potential to alleviate stuttering. As a cyclopyrrolone derivative, it acts as a partial agonist at GABA(A) receptors and modulates inhibitory neurotransmission, giving it a distinctive pharmacological profile.
Pagoclone Chemical Properties
| Boiling point | 582.1±50.0 °C(Predicted) |
| density | 1.273±0.06 g/cm3(Predicted) |
| pka | 1.62±0.30(Predicted) |
| InChI | InChI=1S/C23H22ClN3O2/c1-14(2)7-10-16(28)13-19-17-5-3-4-6-18(17)23(29)27(19)21-12-9-15-8-11-20(24)25-22(15)26-21/h3-6,8-9,11-12,14,19H,7,10,13H2,1-2H3 |
| InChIKey | HIUPRQPBWVEQJJ-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=CC=C2)C(CC(=O)CCC(C)C)N1C1=CC=C2C(=N1)N=C(Cl)C=C2 |
Product Application of Pagoclone CAS#133737-32-3
Pagoclone is a selective modulator of GABA (gamma-aminobutyric acid) receptors that has been studied for its potential to help reduce stuttering. Structurally classified as a cyclopyrrolone derivative, it acts as a partial agonist at GABA(A) receptors, contributing to its distinctive pharmacological characteristics.
